C24H24O9 — CID 53390824
[(2S,3S,4R,6R)-6-[(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methoxy]-4-hydroxy-2,4-dimethyloxan-3-yl] acetate (PubChem CID 53390824) has the molecular formula C24H24O9 and a molecular weight of 456.45 g/mol. Its IUPAC name is [(2S,3S,4R,6R)-6-[(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methoxy]-4-hydroxy-2,4-dimethyloxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,6R)-6-[(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methoxy]-4-hydroxy-2,4-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 53390824 |
| Molecular Formula | C24H24O9 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | [(2S,3S,4R,6R)-6-[(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methoxy]-4-hydroxy-2,4-dimethyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](C)O[C@@H](OCc2cc(O)c3c(c2O)C(=O)c2ccccc2C3=O)C[C@@]1(C)O |
| InChI | InChI=1S/C24H24O9/c1-11-23(33-12(2)25)24(3,30)9-17(32-11)31-10-13-8-16(26)18-19(20(13)27)22(29)15-7-5-4-6-14(15)21(18)28/h4-8,11,17,23,26-27,30H,9-10H2,1-3H3/t11-,17+,23-,24+/m0/s1 |
| InChIKey | JHAZQZUTQDFWJK-RIAVMEDMSA-N |
| XLogP | 2.21 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|