C25H26O9 — CID 53390825
[(2S,3S,4R,6R)-6-[(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methoxy]-4-methoxy-2,4-dimethyloxan-3-yl] acetate (PubChem CID 53390825) has the molecular formula C25H26O9 and a molecular weight of 470.47 g/mol. Its IUPAC name is [(2S,3S,4R,6R)-6-[(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methoxy]-4-methoxy-2,4-dimethyloxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,6R)-6-[(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methoxy]-4-methoxy-2,4-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 53390825 |
| Molecular Formula | C25H26O9 |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | [(2S,3S,4R,6R)-6-[(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methoxy]-4-methoxy-2,4-dimethyloxan-3-yl] acetate |
| SMILES | CO[C@]1(C)C[C@H](OCc2cc(O)c3c(c2O)C(=O)c2ccccc2C3=O)O[C@@H](C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H26O9/c1-12-24(34-13(2)26)25(3,31-4)10-18(33-12)32-11-14-9-17(27)19-20(21(14)28)23(30)16-8-6-5-7-15(16)22(19)29/h5-9,12,18,24,27-28H,10-11H2,1-4H3/t12-,18+,24-,25+/m0/s1 |
| InChIKey | NXTVUFCAILZYTF-AUTOWVFJSA-N |
| XLogP | 2.86 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|