C23H23NO8 — CID 53391086
[(2S,3R,4R,6R)-4-amino-6-[(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methoxy]-2-methyloxan-3-yl] acetate (PubChem CID 53391086) has the molecular formula C23H23NO8 and a molecular weight of 441.44 g/mol. Its IUPAC name is [(2S,3R,4R,6R)-4-amino-6-[(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methoxy]-2-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,6R)-4-amino-6-[(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methoxy]-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 53391086 |
| Molecular Formula | C23H23NO8 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | [(2S,3R,4R,6R)-4-amino-6-[(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methoxy]-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](N)C[C@H](OCc2cc(O)c3c(c2O)C(=O)c2ccccc2C3=O)O[C@H]1C |
| InChI | InChI=1S/C23H23NO8/c1-10-23(32-11(2)25)15(24)8-17(31-10)30-9-12-7-16(26)18-19(20(12)27)22(29)14-6-4-3-5-13(14)21(18)28/h3-7,10,15,17,23,26-27H,8-9,24H2,1-2H3/t10-,15+,17+,23-/m0/s1 |
| InChIKey | RNPVWXNWFSVREU-NWQASQBSSA-N |
| XLogP | 1.78 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|