C25H32O9 — CID 10254399
[(9S,10R)-9,10-dihydroxy-3,5,14,15,16-pentamethoxy-9,10-dimethyl-4-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl] acetate (PubChem CID 10254399) has the molecular formula C25H32O9 and a molecular weight of 476.52 g/mol. Its IUPAC name is [(9S,10R)-9,10-dihydroxy-3,5,14,15,16-pentamethoxy-9,10-dimethyl-4-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl] acetate.
| Compound Name | [(9S,10R)-9,10-dihydroxy-3,5,14,15,16-pentamethoxy-9,10-dimethyl-4-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl] acetate |
|---|---|
| PubChem CID | 10254399 |
| Molecular Formula | C25H32O9 |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | [(9S,10R)-9,10-dihydroxy-3,5,14,15,16-pentamethoxy-9,10-dimethyl-4-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl] acetate |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(cc(OC)c(OC(C)=O)c1OC)C[C@](C)(O)[C@](C)(O)C2 |
| InChI | InChI=1S/C25H32O9/c1-13(26)34-21-17(30-5)10-15-12-25(3,28)24(2,27)11-14-9-16(29-4)20(31-6)22(32-7)18(14)19(15)23(21)33-8/h9-10,27-28H,11-12H2,1-8H3/t24-,25+/m1/s1 |
| InChIKey | WNAHCIORILMCNL-RPBOFIJWSA-N |
| XLogP | 2.92 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|