C23H21NO6 — CID 10835231
methyl 2-[(6R,8R)-6-methyl-5,10-dioxo-4-phenylmethoxy-8,9-dihydro-6H-pyrano[3,4-g]quinolin-8-yl]acetate (PubChem CID 10835231) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is methyl 2-[(6R,8R)-6-methyl-5,10-dioxo-4-phenylmethoxy-8,9-dihydro-6H-pyrano[3,4-g]quinolin-8-yl]acetate.
| Compound Name | methyl 2-[(6R,8R)-6-methyl-5,10-dioxo-4-phenylmethoxy-8,9-dihydro-6H-pyrano[3,4-g]quinolin-8-yl]acetate |
|---|---|
| PubChem CID | 10835231 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | methyl 2-[(6R,8R)-6-methyl-5,10-dioxo-4-phenylmethoxy-8,9-dihydro-6H-pyrano[3,4-g]quinolin-8-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC2=C(C(=O)c3c(OCc4ccccc4)ccnc3C2=O)[C@@H](C)O1 |
| InChI | InChI=1S/C23H21NO6/c1-13-19-16(10-15(30-13)11-18(25)28-2)22(26)21-20(23(19)27)17(8-9-24-21)29-12-14-6-4-3-5-7-14/h3-9,13,15H,10-12H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | DOJNEZVMIZMDBM-UKRRQHHQSA-N |
| XLogP | 3.08 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|