C16H15NO6 — CID 10639170
methyl 2-[(6R,8R)-3-hydroxy-6-methyl-5,10-dioxo-8,9-dihydro-6H-pyrano[3,4-g]quinolin-8-yl]acetate (PubChem CID 10639170) has the molecular formula C16H15NO6 and a molecular weight of 317.30 g/mol. Its IUPAC name is methyl 2-[(6R,8R)-3-hydroxy-6-methyl-5,10-dioxo-8,9-dihydro-6H-pyrano[3,4-g]quinolin-8-yl]acetate.
| Compound Name | methyl 2-[(6R,8R)-3-hydroxy-6-methyl-5,10-dioxo-8,9-dihydro-6H-pyrano[3,4-g]quinolin-8-yl]acetate |
|---|---|
| PubChem CID | 10639170 |
| Molecular Formula | C16H15NO6 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | methyl 2-[(6R,8R)-3-hydroxy-6-methyl-5,10-dioxo-8,9-dihydro-6H-pyrano[3,4-g]quinolin-8-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC2=C(C(=O)c3cc(O)cnc3C2=O)[C@@H](C)O1 |
| InChI | InChI=1S/C16H15NO6/c1-7-13-10(4-9(23-7)5-12(19)22-2)16(21)14-11(15(13)20)3-8(18)6-17-14/h3,6-7,9,18H,4-5H2,1-2H3/t7-,9-/m1/s1 |
| InChIKey | WGJCWJPQHKEDCD-VXNVDRBHSA-N |
| XLogP | 1.20 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|