C17H14O7 — CID 22296307
methyl 2-(5,10-dihydroxy-1-methyl-6,9-dioxo-1H-benzo[g]isochromen-3-yl)acetate (PubChem CID 22296307) has the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. Its IUPAC name is methyl 2-(5,10-dihydroxy-1-methyl-6,9-dioxo-1H-benzo[g]isochromen-3-yl)acetate.
| Compound Name | methyl 2-(5,10-dihydroxy-1-methyl-6,9-dioxo-1H-benzo[g]isochromen-3-yl)acetate |
|---|---|
| PubChem CID | 22296307 |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | methyl 2-(5,10-dihydroxy-1-methyl-6,9-dioxo-1H-benzo[g]isochromen-3-yl)acetate |
| SMILES | COC(=O)CC1=Cc2c(O)c3c(c(O)c2C(C)O1)C(=O)C=CC3=O |
| InChI | InChI=1S/C17H14O7/c1-7-13-9(5-8(24-7)6-12(20)23-2)16(21)14-10(18)3-4-11(19)15(14)17(13)22/h3-5,7,21-22H,6H2,1-2H3 |
| InChIKey | HPSGKISBINYTSF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|