C17H16O4 — CID 162820827
10-hydroxy-3-methyl-1-propyl-1H-benzo[g]isochromene-6,9-dione (PubChem CID 162820827) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is 10-hydroxy-3-methyl-1-propyl-1H-benzo[g]isochromene-6,9-dione.
| Compound Name | 10-hydroxy-3-methyl-1-propyl-1H-benzo[g]isochromene-6,9-dione |
|---|---|
| PubChem CID | 162820827 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 10-hydroxy-3-methyl-1-propyl-1H-benzo[g]isochromene-6,9-dione |
| SMILES | CCCC1OC(C)=Cc2cc3c(c(O)c21)C(=O)C=CC3=O |
| InChI | InChI=1S/C17H16O4/c1-3-4-14-15-10(7-9(2)21-14)8-11-12(18)5-6-13(19)16(11)17(15)20/h5-8,14,20H,3-4H2,1-2H3 |
| InChIKey | XSRXAOMSAQPHJV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|