About 2-ethyl-6-hydroxy-1,3-dioxin-4-one
2-ethyl-6-hydroxy-1,3-dioxin-4-one (PubChem CID 121278242) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is 2-ethyl-6-hydroxy-1,3-dioxin-4-one.
Molecular Properties
| Compound Name | 2-ethyl-6-hydroxy-1,3-dioxin-4-one |
| PubChem CID | 121278242 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 2-ethyl-6-hydroxy-1,3-dioxin-4-one |
| SMILES | CCC1OC(=O)C=C(O)O1 |
| InChI | InChI=1S/C6H8O4/c1-2-6-9-4(7)3-5(8)10-6/h3,6-7H,2H2,1H3 |
| InChIKey | FNRJMRDDOLYXHG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-6-hydroxy-1,3-dioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6-hydroxy-1,3-dioxin-4-one?
The IUPAC name of 2-ethyl-6-hydroxy-1,3-dioxin-4-one (CID 121278242) is 2-ethyl-6-hydroxy-1,3-dioxin-4-one.
What is the SMILES notation for 2-ethyl-6-hydroxy-1,3-dioxin-4-one?
The canonical SMILES for 2-ethyl-6-hydroxy-1,3-dioxin-4-one is CCC1OC(=O)C=C(O)O1.
What is the InChIKey of 2-ethyl-6-hydroxy-1,3-dioxin-4-one?
The InChIKey is FNRJMRDDOLYXHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4/c1-2-6-9-4(7)3-5(8)10-6/h3,6-7H,2H2,1H3.
What are the key properties of 2-ethyl-6-hydroxy-1,3-dioxin-4-one?
2-ethyl-6-hydroxy-1,3-dioxin-4-one has a molecular weight of 144.13 g/mol, XLogP of 0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-hydroxy-1,3-dioxin-4-one is sourced from PubChem (CID 121278242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).