About 1-carboxyoxyethyl prop-2-enoate
1-carboxyoxyethyl prop-2-enoate (PubChem CID 19808593) has the molecular formula C6H8O5
and a molecular weight of 160.12 g/mol. Its IUPAC name is 1-carboxyoxyethyl prop-2-enoate.
Molecular Properties
| Compound Name | 1-carboxyoxyethyl prop-2-enoate |
| PubChem CID | 19808593 |
| Molecular Formula | C6H8O5 |
| Molecular Weight | 160.12 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | 1-carboxyoxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)OC(=O)O |
| InChI | InChI=1S/C6H8O5/c1-3-5(7)10-4(2)11-6(8)9/h3-4H,1H2,2H3,(H,8,9) |
| InChIKey | RNGYMTVWGQGCNV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.12 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-carboxyoxyethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carboxyoxyethyl prop-2-enoate?
The IUPAC name of 1-carboxyoxyethyl prop-2-enoate (CID 19808593) is 1-carboxyoxyethyl prop-2-enoate.
What is the SMILES notation for 1-carboxyoxyethyl prop-2-enoate?
The canonical SMILES for 1-carboxyoxyethyl prop-2-enoate is C=CC(=O)OC(C)OC(=O)O.
What is the InChIKey of 1-carboxyoxyethyl prop-2-enoate?
The InChIKey is RNGYMTVWGQGCNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O5/c1-3-5(7)10-4(2)11-6(8)9/h3-4H,1H2,2H3,(H,8,9).
What are the key properties of 1-carboxyoxyethyl prop-2-enoate?
1-carboxyoxyethyl prop-2-enoate has a molecular weight of 160.12 g/mol, XLogP of 0.76, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carboxyoxyethyl prop-2-enoate is sourced from PubChem (CID 19808593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).