About 1-hydroxyethyl prop-2-enoate
1-hydroxyethyl prop-2-enoate (PubChem CID 14047273) has the molecular formula C5H8O3
and a molecular weight of 116.12 g/mol. Its IUPAC name is 1-hydroxyethyl prop-2-enoate.
Molecular Properties
| Compound Name | 1-hydroxyethyl prop-2-enoate |
| PubChem CID | 14047273 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | 1-hydroxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)O |
| InChI | InChI=1S/C5H8O3/c1-3-5(7)8-4(2)6/h3-4,6H,1H2,2H3 |
| InChIKey | TUAJZTAVXLCEGA-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyethyl prop-2-enoate?
The IUPAC name of 1-hydroxyethyl prop-2-enoate (CID 14047273) is 1-hydroxyethyl prop-2-enoate.
What is the SMILES notation for 1-hydroxyethyl prop-2-enoate?
The canonical SMILES for 1-hydroxyethyl prop-2-enoate is C=CC(=O)OC(C)O.
What is the InChIKey of 1-hydroxyethyl prop-2-enoate?
The InChIKey is TUAJZTAVXLCEGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3/c1-3-5(7)8-4(2)6/h3-4,6H,1H2,2H3.
What are the key properties of 1-hydroxyethyl prop-2-enoate?
1-hydroxyethyl prop-2-enoate has a molecular weight of 116.12 g/mol, XLogP of 0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyethyl prop-2-enoate is sourced from PubChem (CID 14047273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).