C22H22O11 — CID 163052840
2-[(1S,9S,10S,16R,18R)-1,5,10,12,19-pentahydroxy-7,18-dimethyl-3,14-dioxo-8,17-dioxapentacyclo[14.2.2.02,15.04,13.06,11]icosa-2(15),4,6(11),12-tetraen-9-yl]acetic acid (PubChem CID 163052840) has the molecular formula C22H22O11 and a molecular weight of 462.41 g/mol. Its IUPAC name is 2-[(1S,9S,10S,16R,18R)-1,5,10,12,19-pentahydroxy-7,18-dimethyl-3,14-dioxo-8,17-dioxapentacyclo[14.2.2.02,15.04,13.06,11]icosa-2(15),4,6(11),12-tetraen-9-yl]acetic acid.
| Compound Name | 2-[(1S,9S,10S,16R,18R)-1,5,10,12,19-pentahydroxy-7,18-dimethyl-3,14-dioxo-8,17-dioxapentacyclo[14.2.2.02,15.04,13.06,11]icosa-2(15),4,6(11),12-tetraen-9-yl]acetic acid |
|---|---|
| PubChem CID | 163052840 |
| Molecular Formula | C22H22O11 |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 2-[(1S,9S,10S,16R,18R)-1,5,10,12,19-pentahydroxy-7,18-dimethyl-3,14-dioxo-8,17-dioxapentacyclo[14.2.2.02,15.04,13.06,11]icosa-2(15),4,6(11),12-tetraen-9-yl]acetic acid |
| SMILES | CC1O[C@@H](CC(=O)O)[C@@H](O)c2c(O)c3c(c(O)c21)C(=O)C1=C(C3=O)[C@H]2CC(O)[C@]1(O)[C@@H](C)O2 |
| InChI | InChI=1S/C22H22O11/c1-5-11-13(17(26)8(32-5)4-10(24)25)20(29)14-15(18(11)27)21(30)16-12(19(14)28)7-3-9(23)22(16,31)6(2)33-7/h5-9,17,23,26-27,29,31H,3-4H2,1-2H3,(H,24,25)/t5?,6-,7-,8+,9?,17-,22-/m1/s1 |
| InChIKey | ABHOBVJKBDCTNB-RASVIDEYSA-N |
| XLogP | 0.02 |
| TPSA | 191.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|