C23H22O9 — CID 162899167
(1R,7S,11S,13S,19S,20R,23S)-5,15,19,23-tetrahydroxy-13,20-dimethyl-8,21-dioxahexacyclo[17.2.2.02,18.04,16.06,14.07,11]tricosa-2(18),4,6(14),15-tetraene-3,9,17-trione (PubChem CID 162899167) has the molecular formula C23H22O9 and a molecular weight of 442.42 g/mol. Its IUPAC name is (1R,7S,11S,13S,19S,20R,23S)-5,15,19,23-tetrahydroxy-13,20-dimethyl-8,21-dioxahexacyclo[17.2.2.02,18.04,16.06,14.07,11]tricosa-2(18),4,6(14),15-tetraene-3,9,17-trione.
| Compound Name | (1R,7S,11S,13S,19S,20R,23S)-5,15,19,23-tetrahydroxy-13,20-dimethyl-8,21-dioxahexacyclo[17.2.2.02,18.04,16.06,14.07,11]tricosa-2(18),4,6(14),15-tetraene-3,9,17-trione |
|---|---|
| PubChem CID | 162899167 |
| Molecular Formula | C23H22O9 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | (1R,7S,11S,13S,19S,20R,23S)-5,15,19,23-tetrahydroxy-13,20-dimethyl-8,21-dioxahexacyclo[17.2.2.02,18.04,16.06,14.07,11]tricosa-2(18),4,6(14),15-tetraene-3,9,17-trione |
| SMILES | C[C@H]1C[C@H]2CC(=O)O[C@@H]2c2c(O)c3c(c(O)c21)C(=O)C1=C(C3=O)[C@H]2C[C@H](O)[C@]1(O)[C@@H](C)O2 |
| InChI | InChI=1S/C23H22O9/c1-6-3-8-4-11(25)32-22(8)16-12(6)18(26)15-14(20(16)28)19(27)13-9-5-10(24)23(30,7(2)31-9)17(13)21(15)29/h6-10,22,24,26,28,30H,3-5H2,1-2H3/t6-,7+,8-,9+,10-,22-,23+/m0/s1 |
| InChIKey | GBIXIKAQDQQMMS-LACCEBPMSA-N |
| XLogP | 1.17 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|