C22H20O10 — CID 137071581
2-(2,5,6,11-tetrahydroxy-7,18-dimethyl-13,20-dioxo-8,17-dioxahexacyclo[10.8.0.03,10.04,6.04,9.014,19]icosa-1,3(10),11,14(19)-tetraen-16-yl)acetic acid (PubChem CID 137071581) has the molecular formula C22H20O10 and a molecular weight of 444.39 g/mol. Its IUPAC name is 2-(2,5,6,11-tetrahydroxy-7,18-dimethyl-13,20-dioxo-8,17-dioxahexacyclo[10.8.0.03,10.04,6.04,9.014,19]icosa-1,3(10),11,14(19)-tetraen-16-yl)acetic acid.
| Compound Name | 2-(2,5,6,11-tetrahydroxy-7,18-dimethyl-13,20-dioxo-8,17-dioxahexacyclo[10.8.0.03,10.04,6.04,9.014,19]icosa-1,3(10),11,14(19)-tetraen-16-yl)acetic acid |
|---|---|
| PubChem CID | 137071581 |
| Molecular Formula | C22H20O10 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 2-(2,5,6,11-tetrahydroxy-7,18-dimethyl-13,20-dioxo-8,17-dioxahexacyclo[10.8.0.03,10.04,6.04,9.014,19]icosa-1,3(10),11,14(19)-tetraen-16-yl)acetic acid |
| SMILES | CC1OC(CC(=O)O)CC2=C1C(=O)c1c(O)c3c(c(O)c1C2=O)C1OC(C)C2(O)C(O)C312 |
| InChI | InChI=1S/C22H20O10/c1-5-10-8(3-7(31-5)4-9(23)24)15(25)11-12(16(10)26)18(28)14-13(17(11)27)19-21(14)20(29)22(21,30)6(2)32-19/h5-7,19-20,27-30H,3-4H2,1-2H3,(H,23,24) |
| InChIKey | OFUVIAJJJMCDNJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|