C23H22O8 — CID 118909258
(16R,18S)-5,6,20-trihydroxy-7,18-dimethyl-16-(2-oxopropyl)-8,17-dioxahexacyclo[10.8.0.03,10.04,6.04,9.014,19]icosa-1(12),3(10),13,19-tetraene-2,11-dione (PubChem CID 118909258) has the molecular formula C23H22O8 and a molecular weight of 426.42 g/mol. Its IUPAC name is (16R,18S)-5,6,20-trihydroxy-7,18-dimethyl-16-(2-oxopropyl)-8,17-dioxahexacyclo[10.8.0.03,10.04,6.04,9.014,19]icosa-1(12),3(10),13,19-tetraene-2,11-dione.
| Compound Name | (16R,18S)-5,6,20-trihydroxy-7,18-dimethyl-16-(2-oxopropyl)-8,17-dioxahexacyclo[10.8.0.03,10.04,6.04,9.014,19]icosa-1(12),3(10),13,19-tetraene-2,11-dione |
|---|---|
| PubChem CID | 118909258 |
| Molecular Formula | C23H22O8 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | (16R,18S)-5,6,20-trihydroxy-7,18-dimethyl-16-(2-oxopropyl)-8,17-dioxahexacyclo[10.8.0.03,10.04,6.04,9.014,19]icosa-1(12),3(10),13,19-tetraene-2,11-dione |
| SMILES | CC(=O)C[C@H]1Cc2cc3c(c(O)c2[C@H](C)O1)C(=O)C1=C(C3=O)C2OC(C)C3(O)C(O)C123 |
| InChI | InChI=1S/C23H22O8/c1-7(24)4-11-5-10-6-12-14(18(26)13(10)8(2)30-11)19(27)16-15(17(12)25)20-22(16)21(28)23(22,29)9(3)31-20/h6,8-9,11,20-21,26,28-29H,4-5H2,1-3H3/t8-,9?,11-,20?,21?,22?,23?/m0/s1 |
| InChIKey | MXHBTCNFQQKASP-NYABYRHRSA-N |
| XLogP | 0.94 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|