C15H10O4 — CID 167616172
5,13-dihydroxytricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-8,10-dione (PubChem CID 167616172) has the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. Its IUPAC name is 5,13-dihydroxytricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-8,10-dione.
| Compound Name | 5,13-dihydroxytricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-8,10-dione |
|---|---|
| PubChem CID | 167616172 |
| Molecular Formula | C15H10O4 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 5,13-dihydroxytricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-8,10-dione |
| SMILES | O=C1CC(=O)c2cc(O)ccc2-c2ccc(O)cc21 |
| InChI | InChI=1S/C15H10O4/c16-8-1-3-10-11-4-2-9(17)6-13(11)15(19)7-14(18)12(10)5-8/h1-6,16-17H,7H2 |
| InChIKey | LTQLJNWPVLPWPD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|