C9H6O4 — CID 139638002
2,5-dihydroxyindene-1,3-dione (PubChem CID 139638002) has the molecular formula C9H6O4 and a molecular weight of 178.14 g/mol. Its IUPAC name is 2,5-dihydroxyindene-1,3-dione.
| Compound Name | 2,5-dihydroxyindene-1,3-dione |
|---|---|
| PubChem CID | 139638002 |
| Molecular Formula | C9H6O4 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 2,5-dihydroxyindene-1,3-dione |
| SMILES | O=C1c2ccc(O)cc2C(=O)C1O |
| InChI | InChI=1S/C9H6O4/c10-4-1-2-5-6(3-4)8(12)9(13)7(5)11/h1-3,9-10,13H |
| InChIKey | IEBSULMRIFURQR-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|