C14H10O4 — CID 143428486
2,6,10-trihydroxy-10H-anthracen-9-one (PubChem CID 143428486) has the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. Its IUPAC name is 2,6,10-trihydroxy-10H-anthracen-9-one.
| Compound Name | 2,6,10-trihydroxy-10H-anthracen-9-one |
|---|---|
| PubChem CID | 143428486 |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2,6,10-trihydroxy-10H-anthracen-9-one |
| SMILES | O=C1c2cc(O)ccc2C(O)c2cc(O)ccc21 |
| InChI | InChI=1S/C14H10O4/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6,13,15-17H |
| InChIKey | YFHNOVONVCFLGX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |