C17H18O4 — CID 139424925
(11S)-5,13-dihydroxy-11,12-dimethyltricyclo[9.4.0.03,8]pentadeca-3(8),4,6,14-tetraene-2,9-dione (PubChem CID 139424925) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is (11S)-5,13-dihydroxy-11,12-dimethyltricyclo[9.4.0.03,8]pentadeca-3(8),4,6,14-tetraene-2,9-dione.
| Compound Name | (11S)-5,13-dihydroxy-11,12-dimethyltricyclo[9.4.0.03,8]pentadeca-3(8),4,6,14-tetraene-2,9-dione |
|---|---|
| PubChem CID | 139424925 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (11S)-5,13-dihydroxy-11,12-dimethyltricyclo[9.4.0.03,8]pentadeca-3(8),4,6,14-tetraene-2,9-dione |
| SMILES | CC1C(O)C=CC2C(=O)c3cc(O)ccc3C(=O)C[C@]21C |
| InChI | InChI=1S/C17H18O4/c1-9-14(19)6-5-13-16(21)12-7-10(18)3-4-11(12)15(20)8-17(9,13)2/h3-7,9,13-14,18-19H,8H2,1-2H3/t9?,13?,14?,17-/m0/s1 |
| InChIKey | NDBIWLPCAZGFGU-ATHUYQOISA-N |
| XLogP | 2.35 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|