C19H24O3 — CID 159579931
(17S)-3,17-dihydroxy-7,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one (PubChem CID 159579931) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (17S)-3,17-dihydroxy-7,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (17S)-3,17-dihydroxy-7,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 159579931 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (17S)-3,17-dihydroxy-7,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one |
| SMILES | CC1C(=O)c2cc(O)ccc2C2CCC3(C)C(CC[C@@H]3O)C12 |
| InChI | InChI=1S/C19H24O3/c1-10-17-13(7-8-19(2)15(17)5-6-16(19)21)12-4-3-11(20)9-14(12)18(10)22/h3-4,9-10,13,15-17,20-21H,5-8H2,1-2H3/t10?,13?,15?,16-,17?,19?/m0/s1 |
| InChIKey | VAKAKTOYDRPZGZ-JZAQTVKLSA-N |
| XLogP | 3.50 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |