C26H30O3 — CID 15291472
(8R,9S,13S,14S,17S)-6-(4-hydroxy-3,5-dimethylphenyl)-13-methyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 15291472) has the molecular formula C26H30O3 and a molecular weight of 390.52 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-6-(4-hydroxy-3,5-dimethylphenyl)-13-methyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17S)-6-(4-hydroxy-3,5-dimethylphenyl)-13-methyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 15291472 |
| Molecular Formula | C26H30O3 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (8R,9S,13S,14S,17S)-6-(4-hydroxy-3,5-dimethylphenyl)-13-methyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | Cc1cc(C2=C[C@@H]3[C@H](CC[C@]4(C)[C@@H](O)CC[C@@H]34)c3ccc(O)cc32)cc(C)c1O |
| InChI | InChI=1S/C26H30O3/c1-14-10-16(11-15(2)25(14)29)20-13-22-19(18-5-4-17(27)12-21(18)20)8-9-26(3)23(22)6-7-24(26)28/h4-5,10-13,19,22-24,27-29H,6-9H2,1-3H3/t19-,22-,23+,24+,26+/m1/s1 |
| InChIKey | DXGBOMSQRWKFEP-OWFOCKTKSA-N |
| XLogP | 5.43 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |