C17H24O2 — CID 58388362
(1S,3aR,7aS)-5-(4-hydroxy-2-methylphenyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-ol (PubChem CID 58388362) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (1S,3aR,7aS)-5-(4-hydroxy-2-methylphenyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-ol.
| Compound Name | (1S,3aR,7aS)-5-(4-hydroxy-2-methylphenyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-ol |
|---|---|
| PubChem CID | 58388362 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (1S,3aR,7aS)-5-(4-hydroxy-2-methylphenyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-ol |
| SMILES | Cc1cc(O)ccc1C1CC[C@@]2(C)[C@H](CC[C@@H]2O)C1 |
| InChI | InChI=1S/C17H24O2/c1-11-9-14(18)4-5-15(11)12-7-8-17(2)13(10-12)3-6-16(17)19/h4-5,9,12-13,16,18-19H,3,6-8,10H2,1-2H3/t12?,13-,16+,17+/m1/s1 |
| InChIKey | ZTEAIIVUHZBCFL-WHICFHTQSA-N |
| XLogP | 3.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |