C26H31NO2 — CID 15291471
(8R,9S,13S,14S,17S)-6-[4-(dimethylamino)phenyl]-13-methyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 15291471) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-6-[4-(dimethylamino)phenyl]-13-methyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17S)-6-[4-(dimethylamino)phenyl]-13-methyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 15291471 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | (8R,9S,13S,14S,17S)-6-[4-(dimethylamino)phenyl]-13-methyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CN(C)c1ccc(C2=C[C@@H]3[C@H](CC[C@]4(C)[C@@H](O)CC[C@@H]34)c3ccc(O)cc32)cc1 |
| InChI | InChI=1S/C26H31NO2/c1-26-13-12-20-19-9-8-18(28)14-22(19)21(15-23(20)24(26)10-11-25(26)29)16-4-6-17(7-5-16)27(2)3/h4-9,14-15,20,23-25,28-29H,10-13H2,1-3H3/t20-,23-,24+,25+,26+/m1/s1 |
| InChIKey | RXSCFYIXVDSFJH-MTKOPPBXSA-N |
| XLogP | 5.17 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|