C24H27BrO3S — CID 53323081
(7S,8R,9S,13S,14S,17S)-7-(4-bromophenyl)sulfanyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,6,17-triol (PubChem CID 53323081) has the molecular formula C24H27BrO3S and a molecular weight of 475.45 g/mol. Its IUPAC name is (7S,8R,9S,13S,14S,17S)-7-(4-bromophenyl)sulfanyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,6,17-triol.
| Compound Name | (7S,8R,9S,13S,14S,17S)-7-(4-bromophenyl)sulfanyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,6,17-triol |
|---|---|
| PubChem CID | 53323081 |
| Molecular Formula | C24H27BrO3S |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | (7S,8R,9S,13S,14S,17S)-7-(4-bromophenyl)sulfanyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,6,17-triol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4C(O)[C@@H](Sc4ccc(Br)cc4)[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C24H27BrO3S/c1-24-11-10-17-16-7-4-14(26)12-18(16)22(28)23(21(17)19(24)8-9-20(24)27)29-15-5-2-13(25)3-6-15/h2-7,12,17,19-23,26-28H,8-11H2,1H3/t17-,19+,20+,21-,22?,23+,24+/m1/s1 |
| InChIKey | XEKKTAYAEIHJEA-IFDMWSDSSA-N |
| XLogP | 5.63 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |