C34H55NO4S — CID 15543008
N-butyl-N-methyl-11-[[(6R,7S,8R,9S,13S,14S,17S)-3,6,17-trihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]sulfanyl]undecanamide (PubChem CID 15543008) has the molecular formula C34H55NO4S and a molecular weight of 573.88 g/mol. Its IUPAC name is N-butyl-N-methyl-11-[[(6R,7S,8R,9S,13S,14S,17S)-3,6,17-trihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]sulfanyl]undecanamide.
| Compound Name | N-butyl-N-methyl-11-[[(6R,7S,8R,9S,13S,14S,17S)-3,6,17-trihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]sulfanyl]undecanamide |
|---|---|
| PubChem CID | 15543008 |
| Molecular Formula | C34H55NO4S |
| Molecular Weight | 573.88 g/mol |
| Exact Mass | 573.39 |
| IUPAC Name | N-butyl-N-methyl-11-[[(6R,7S,8R,9S,13S,14S,17S)-3,6,17-trihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]sulfanyl]undecanamide |
| SMILES | CCCCN(C)C(=O)CCCCCCCCCCS[C@H]1[C@@H]2[C@H](CC[C@]3(C)[C@@H](O)CC[C@@H]23)c2ccc(O)cc2[C@H]1O |
| InChI | InChI=1S/C34H55NO4S/c1-4-5-21-35(3)30(38)14-12-10-8-6-7-9-11-13-22-40-33-31-26(19-20-34(2)28(31)17-18-29(34)37)25-16-15-24(36)23-27(25)32(33)39/h15-16,23,26,28-29,31-33,36-37,39H,4-14,17-22H2,1-3H3/t26-,28+,29+,31-,32-,33+,34+/m1/s1 |
| InChIKey | BCOZZDRWMQBVGK-VZQPPDIBSA-N |
| XLogP | 7.58 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.88 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|