C29H36O4 — CID 90287714
(7S,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-7-(4-phenylmethoxybutyl)-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one (PubChem CID 90287714) has the molecular formula C29H36O4 and a molecular weight of 448.60 g/mol. Its IUPAC name is (7S,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-7-(4-phenylmethoxybutyl)-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (7S,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-7-(4-phenylmethoxybutyl)-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 90287714 |
| Molecular Formula | C29H36O4 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (7S,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-7-(4-phenylmethoxybutyl)-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4C(=O)[C@@H](CCCCOCc4ccccc4)[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C29H36O4/c1-29-15-14-22-21-11-10-20(30)17-24(21)28(32)23(27(22)25(29)12-13-26(29)31)9-5-6-16-33-18-19-7-3-2-4-8-19/h2-4,7-8,10-11,17,22-23,25-27,30-31H,5-6,9,12-16,18H2,1H3/t22-,23+,25+,26+,27+,29+/m1/s1 |
| InChIKey | XFTRJXNXTAZZFW-WGRPDLKCSA-N |
| XLogP | 5.86 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|