C22H31NO6S — CID 15497808
4-[(E)-[(8R,9S,13S,14S)-3,17-dihydroxy-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-ylidene]amino]oxybutane-1-sulfonic acid (PubChem CID 15497808) has the molecular formula C22H31NO6S and a molecular weight of 437.56 g/mol. Its IUPAC name is 4-[(E)-[(8R,9S,13S,14S)-3,17-dihydroxy-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-ylidene]amino]oxybutane-1-sulfonic acid.
| Compound Name | 4-[(E)-[(8R,9S,13S,14S)-3,17-dihydroxy-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-ylidene]amino]oxybutane-1-sulfonic acid |
|---|---|
| PubChem CID | 15497808 |
| Molecular Formula | C22H31NO6S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 4-[(E)-[(8R,9S,13S,14S)-3,17-dihydroxy-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-ylidene]amino]oxybutane-1-sulfonic acid |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4/C(=N/OCCCCS(=O)(=O)O)C[C@H]3[C@@H]1CCC2O |
| InChI | InChI=1S/C22H31NO6S/c1-22-9-8-16-15-5-4-14(24)12-18(15)20(13-17(16)19(22)6-7-21(22)25)23-29-10-2-3-11-30(26,27)28/h4-5,12,16-17,19,21,24-25H,2-3,6-11,13H2,1H3,(H,26,27,28)/b23-20+/t16-,17-,19+,21?,22+/m1/s1 |
| InChIKey | MZTRTAVOPQKIPI-HZZKGJPXSA-N |
| XLogP | 3.46 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|