C27H30F3NO5 — CID 152759235
(8R,9S,13S,14S)-2-methoxy-13-methyl-6-[[4-(trifluoromethoxy)phenyl]methoxyimino]-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 152759235) has the molecular formula C27H30F3NO5 and a molecular weight of 505.53 g/mol. Its IUPAC name is (8R,9S,13S,14S)-2-methoxy-13-methyl-6-[[4-(trifluoromethoxy)phenyl]methoxyimino]-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S)-2-methoxy-13-methyl-6-[[4-(trifluoromethoxy)phenyl]methoxyimino]-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 152759235 |
| Molecular Formula | C27H30F3NO5 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | (8R,9S,13S,14S)-2-methoxy-13-methyl-6-[[4-(trifluoromethoxy)phenyl]methoxyimino]-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | COc1cc2c(cc1O)C(=NOCc1ccc(OC(F)(F)F)cc1)C[C@@H]1[C@@H]2CC[C@]2(C)C(O)CC[C@@H]12 |
| InChI | InChI=1S/C27H30F3NO5/c1-26-10-9-17-18-13-24(34-2)23(32)12-20(18)22(11-19(17)21(26)7-8-25(26)33)31-35-14-15-3-5-16(6-4-15)36-27(28,29)30/h3-6,12-13,17,19,21,25,32-33H,7-11,14H2,1-2H3/t17-,19-,21+,25?,26+/m1/s1 |
| InChIKey | SNGLFTSIPHIJDG-AGIISBBLSA-N |
| XLogP | 5.89 |
| TPSA | 80.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|