C27H32N2O5 — CID 11476806
(6E,8R,9S,13S,14S,17Z)-17-hydroxyimino-2-methoxy-6-[(4-methoxyphenyl)methoxyimino]-13-methyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 11476806) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is (6E,8R,9S,13S,14S,17Z)-17-hydroxyimino-2-methoxy-6-[(4-methoxyphenyl)methoxyimino]-13-methyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (6E,8R,9S,13S,14S,17Z)-17-hydroxyimino-2-methoxy-6-[(4-methoxyphenyl)methoxyimino]-13-methyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 11476806 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | (6E,8R,9S,13S,14S,17Z)-17-hydroxyimino-2-methoxy-6-[(4-methoxyphenyl)methoxyimino]-13-methyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | COc1ccc(CO/N=C2\C[C@@H]3[C@H](CC[C@]4(C)/C(=N\O)CC[C@@H]34)c3cc(OC)c(O)cc32)cc1 |
| InChI | InChI=1S/C27H32N2O5/c1-27-11-10-18-19-14-25(33-3)24(30)13-21(19)23(12-20(18)22(27)8-9-26(27)28-31)29-34-15-16-4-6-17(32-2)7-5-16/h4-7,13-14,18,20,22,30-31H,8-12,15H2,1-3H3/b28-26-,29-23+/t18-,20-,22+,27+/m1/s1 |
| InChIKey | ZXTJUBOIULDZJJ-MYSOSYIZSA-N |
| XLogP | 5.47 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|