C25H27N5O7 — CID 87849868
(8R,9S,13S,14S)-6-[(2,4-dinitrophenyl)hydrazinylidene]-17-hydroxyimino-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 87849868) has the molecular formula C25H27N5O7 and a molecular weight of 509.52 g/mol. Its IUPAC name is (8R,9S,13S,14S)-6-[(2,4-dinitrophenyl)hydrazinylidene]-17-hydroxyimino-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (8R,9S,13S,14S)-6-[(2,4-dinitrophenyl)hydrazinylidene]-17-hydroxyimino-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 87849868 |
| Molecular Formula | C25H27N5O7 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | (8R,9S,13S,14S)-6-[(2,4-dinitrophenyl)hydrazinylidene]-17-hydroxyimino-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | COc1cc2c(cc1O)C(=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C[C@@H]1[C@@H]2CC[C@]2(C)C(=NO)CC[C@@H]12 |
| InChI | InChI=1S/C25H27N5O7/c1-25-8-7-14-15-12-23(37-2)22(31)11-17(15)20(10-16(14)18(25)4-6-24(25)28-32)27-26-19-5-3-13(29(33)34)9-21(19)30(35)36/h3,5,9,11-12,14,16,18,26,31-32H,4,6-8,10H2,1-2H3/t14-,16-,18+,25+/m1/s1 |
| InChIKey | MRYOCZRQYYOBCX-LIFKCWCWSA-N |
| XLogP | 5.18 |
| TPSA | 172.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|