C26H30N2O5 — CID 91604489
(8R,9S,13S,14S)-2-methoxy-13-methyl-17-[(4-nitrophenyl)methoxyamino]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 91604489) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is (8R,9S,13S,14S)-2-methoxy-13-methyl-17-[(4-nitrophenyl)methoxyamino]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (8R,9S,13S,14S)-2-methoxy-13-methyl-17-[(4-nitrophenyl)methoxyamino]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 91604489 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | (8R,9S,13S,14S)-2-methoxy-13-methyl-17-[(4-nitrophenyl)methoxyamino]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | COc1cc2c(cc1O)CC[C@@H]1[C@@H]2CC[C@]2(C)C(NOCc3ccc([N+](=O)[O-])cc3)=CC[C@@H]12 |
| InChI | InChI=1S/C26H30N2O5/c1-26-12-11-19-20(8-5-17-13-23(29)24(32-2)14-21(17)19)22(26)9-10-25(26)27-33-15-16-3-6-18(7-4-16)28(30)31/h3-4,6-7,10,13-14,19-20,22,27,29H,5,8-9,11-12,15H2,1-2H3/t19-,20+,22-,26-/m0/s1 |
| InChIKey | VABKINKPQPFOEK-JCISHKRCSA-N |
| XLogP | 5.38 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|