C30H40O3 — CID 10138691
(13S,17R)-17-[(4-tert-butylphenyl)methyl]-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 10138691) has the molecular formula C30H40O3 and a molecular weight of 448.65 g/mol. Its IUPAC name is (13S,17R)-17-[(4-tert-butylphenyl)methyl]-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (13S,17R)-17-[(4-tert-butylphenyl)methyl]-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 10138691 |
| Molecular Formula | C30H40O3 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (13S,17R)-17-[(4-tert-butylphenyl)methyl]-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | COc1cc2c(cc1O)CCC1C2CC[C@@]2(C)C1CC[C@@]2(O)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H40O3/c1-28(2,3)21-9-6-19(7-10-21)18-30(32)15-13-25-23-11-8-20-16-26(31)27(33-5)17-24(20)22(23)12-14-29(25,30)4/h6-7,9-10,16-17,22-23,25,31-32H,8,11-15,18H2,1-5H3/t22?,23?,25?,29-,30+/m0/s1 |
| InChIKey | ALDXCNDQCJXWIF-CXPFLZDCSA-N |
| XLogP | 6.53 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |