C30H41NO4S2 — CID 69206355
[17-[(4-tert-butylphenyl)methyl]-17-hydroxy-13-methyl-2-methylsulfanyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate (PubChem CID 69206355) has the molecular formula C30H41NO4S2 and a molecular weight of 543.80 g/mol. Its IUPAC name is [17-[(4-tert-butylphenyl)methyl]-17-hydroxy-13-methyl-2-methylsulfanyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate.
| Compound Name | [17-[(4-tert-butylphenyl)methyl]-17-hydroxy-13-methyl-2-methylsulfanyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate |
|---|---|
| PubChem CID | 69206355 |
| Molecular Formula | C30H41NO4S2 |
| Molecular Weight | 543.80 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | [17-[(4-tert-butylphenyl)methyl]-17-hydroxy-13-methyl-2-methylsulfanyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate |
| SMILES | CSc1cc2c(cc1OS(N)(=O)=O)CCC1C2CCC2(C)C1CCC2(O)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H41NO4S2/c1-28(2,3)21-9-6-19(7-10-21)18-30(32)15-13-25-23-11-8-20-16-26(35-37(31,33)34)27(36-5)17-24(20)22(23)12-14-29(25,30)4/h6-7,9-10,16-17,22-23,25,32H,8,11-15,18H2,1-5H3,(H2,31,33,34) |
| InChIKey | FCTWATYKCCYZAI-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.80 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |