C30H41NO4S — CID 46882367
(8R,9S,13S,14S)-17-[(4-tert-butylphenyl)methyl]-17-hydroxy-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-sulfonamide (PubChem CID 46882367) has the molecular formula C30H41NO4S and a molecular weight of 511.73 g/mol. Its IUPAC name is (8R,9S,13S,14S)-17-[(4-tert-butylphenyl)methyl]-17-hydroxy-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-sulfonamide.
| Compound Name | (8R,9S,13S,14S)-17-[(4-tert-butylphenyl)methyl]-17-hydroxy-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-sulfonamide |
|---|---|
| PubChem CID | 46882367 |
| Molecular Formula | C30H41NO4S |
| Molecular Weight | 511.73 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | (8R,9S,13S,14S)-17-[(4-tert-butylphenyl)methyl]-17-hydroxy-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-sulfonamide |
| SMILES | COc1cc2c(cc1S(N)(=O)=O)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CCC2(O)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H41NO4S/c1-28(2,3)21-9-6-19(7-10-21)18-30(32)15-13-25-23-11-8-20-16-27(36(31,33)34)26(35-5)17-24(20)22(23)12-14-29(25,30)4/h6-7,9-10,16-17,22-23,25,32H,8,11-15,18H2,1-5H3,(H2,31,33,34)/t22-,23+,25-,29-,30?/m0/s1 |
| InChIKey | NZYQUFTWESZXFZ-HODYERDKSA-N |
| XLogP | 5.47 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.73 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |