C30H45NO4S — CID 127053168
[(8R,9S,10R,13S,14S,17R)-17-[(4-tert-butylphenyl)methyl]-17-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] sulfamate (PubChem CID 127053168) has the molecular formula C30H45NO4S and a molecular weight of 515.76 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17R)-17-[(4-tert-butylphenyl)methyl]-17-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] sulfamate.
| Compound Name | [(8R,9S,10R,13S,14S,17R)-17-[(4-tert-butylphenyl)methyl]-17-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] sulfamate |
|---|---|
| PubChem CID | 127053168 |
| Molecular Formula | C30H45NO4S |
| Molecular Weight | 515.76 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17R)-17-[(4-tert-butylphenyl)methyl]-17-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] sulfamate |
| SMILES | CC(C)(C)c1ccc(C[C@]2(O)CC[C@H]3[C@@H]4CC=C5CC(OS(N)(=O)=O)CC[C@]5(C)[C@H]4CC[C@@]32C)cc1 |
| InChI | InChI=1S/C30H45NO4S/c1-27(2,3)21-8-6-20(7-9-21)19-30(32)17-14-26-24-11-10-22-18-23(35-36(31,33)34)12-15-28(22,4)25(24)13-16-29(26,30)5/h6-10,23-26,32H,11-19H2,1-5H3,(H2,31,33,34)/t23?,24-,25+,26+,28+,29+,30-/m1/s1 |
| InChIKey | FHHHJWXRFGAVKG-CASLYNHOSA-N |
| XLogP | 5.81 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.76 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|