C26H43NO3 — CID 99572567
(3R,8R,9S,10R,13S,14S,17S)-17-(2-aminoethyl)-10,13-dimethyl-3-[(2R)-oxan-2-yl]oxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 99572567) has the molecular formula C26H43NO3 and a molecular weight of 417.63 g/mol. Its IUPAC name is (3R,8R,9S,10R,13S,14S,17S)-17-(2-aminoethyl)-10,13-dimethyl-3-[(2R)-oxan-2-yl]oxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (3R,8R,9S,10R,13S,14S,17S)-17-(2-aminoethyl)-10,13-dimethyl-3-[(2R)-oxan-2-yl]oxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 99572567 |
| Molecular Formula | C26H43NO3 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.32 |
| IUPAC Name | (3R,8R,9S,10R,13S,14S,17S)-17-(2-aminoethyl)-10,13-dimethyl-3-[(2R)-oxan-2-yl]oxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CC[C@@H](O[C@@H]3CCCCO3)CC1=CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(O)CCN |
| InChI | InChI=1S/C26H43NO3/c1-24-11-8-19(30-23-5-3-4-16-29-23)17-18(24)6-7-20-21(24)9-12-25(2)22(20)10-13-26(25,28)14-15-27/h6,19-23,28H,3-5,7-17,27H2,1-2H3/t19-,20-,21+,22+,23-,24+,25+,26+/m1/s1 |
| InChIKey | RQLXCBXLAWPNRI-YQNXASARSA-N |
| XLogP | 4.94 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|