C30H45BrO4 — CID 58872612
2-[[(3S,10R,13S,17S)-10-[(Z)-2-bromoethenyl]-13-methyl-3-(oxan-2-yloxy)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]oxane (PubChem CID 58872612) has the molecular formula C30H45BrO4 and a molecular weight of 549.59 g/mol. Its IUPAC name is 2-[[(3S,10R,13S,17S)-10-[(Z)-2-bromoethenyl]-13-methyl-3-(oxan-2-yloxy)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]oxane.
| Compound Name | 2-[[(3S,10R,13S,17S)-10-[(Z)-2-bromoethenyl]-13-methyl-3-(oxan-2-yloxy)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]oxane |
|---|---|
| PubChem CID | 58872612 |
| Molecular Formula | C30H45BrO4 |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 2-[[(3S,10R,13S,17S)-10-[(Z)-2-bromoethenyl]-13-methyl-3-(oxan-2-yloxy)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]oxane |
| SMILES | C[C@]12CCC3C(CC=C4C[C@@H](OC5CCCCO5)CC[C@@]43/C=C\Br)C1CC[C@@H]2OC1CCCCO1 |
| InChI | InChI=1S/C30H45BrO4/c1-29-14-13-25-23(24(29)10-11-26(29)35-28-7-3-5-19-33-28)9-8-21-20-22(12-15-30(21,25)16-17-31)34-27-6-2-4-18-32-27/h8,16-17,22-28H,2-7,9-15,18-20H2,1H3/b17-16-/t22-,23?,24?,25?,26-,27?,28?,29-,30+/m0/s1 |
| InChIKey | DLOSWGYNRHNZST-BIANHCMSSA-N |
| XLogP | 7.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|