C26H38F2O3 — CID 15085895
2-[[(3S,8R,9S,10R,13S,14S,17S)-17-ethenoxy-4,4-difluoro-10,13-dimethyl-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]oxane (PubChem CID 15085895) has the molecular formula C26H38F2O3 and a molecular weight of 436.58 g/mol. Its IUPAC name is 2-[[(3S,8R,9S,10R,13S,14S,17S)-17-ethenoxy-4,4-difluoro-10,13-dimethyl-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]oxane.
| Compound Name | 2-[[(3S,8R,9S,10R,13S,14S,17S)-17-ethenoxy-4,4-difluoro-10,13-dimethyl-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]oxane |
|---|---|
| PubChem CID | 15085895 |
| Molecular Formula | C26H38F2O3 |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 2-[[(3S,8R,9S,10R,13S,14S,17S)-17-ethenoxy-4,4-difluoro-10,13-dimethyl-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]oxane |
| SMILES | C=CO[C@H]1CC[C@H]2[C@@H]3CC=C4C(F)(F)[C@@H](OC5CCCCO5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H38F2O3/c1-4-29-21-11-9-18-17-8-10-20-24(2,19(17)12-14-25(18,21)3)15-13-22(26(20,27)28)31-23-7-5-6-16-30-23/h4,10,17-19,21-23H,1,5-9,11-16H2,2-3H3/t17-,18-,19-,21-,22-,23?,24+,25-/m0/s1 |
| InChIKey | GAZUWBCJSDNYPD-DYIOXWFRSA-N |
| XLogP | 6.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|