C25H38O4 — CID 99576637
[(8'R,9'S,10'R,13'S,14'S,17'R)-4',4',10',13'-tetramethylspiro[1,3-dioxolane-2,3'-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl] acetate (PubChem CID 99576637) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is [(8'R,9'S,10'R,13'S,14'S,17'R)-4',4',10',13'-tetramethylspiro[1,3-dioxolane-2,3'-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl] acetate.
| Compound Name | [(8'R,9'S,10'R,13'S,14'S,17'R)-4',4',10',13'-tetramethylspiro[1,3-dioxolane-2,3'-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl] acetate |
|---|---|
| PubChem CID | 99576637 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | [(8'R,9'S,10'R,13'S,14'S,17'R)-4',4',10',13'-tetramethylspiro[1,3-dioxolane-2,3'-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@H]2[C@@H]3CC=C4C(C)(C)C5(CC[C@]4(C)[C@H]3CC[C@]12C)OCCO5 |
| InChI | InChI=1S/C25H38O4/c1-16(26)29-21-9-7-18-17-6-8-20-22(2,3)25(27-14-15-28-25)13-12-23(20,4)19(17)10-11-24(18,21)5/h8,17-19,21H,6-7,9-15H2,1-5H3/t17-,18-,19-,21+,23+,24-/m0/s1 |
| InChIKey | KSCYGVKBSKASRS-RAPVPNNWSA-N |
| XLogP | 5.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|