C21H29FO3 — CID 101288230
[(3S,8S,9S,10S,13S,14S,17S)-3-fluoro-10-formyl-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 101288230) has the molecular formula C21H29FO3 and a molecular weight of 348.46 g/mol. Its IUPAC name is [(3S,8S,9S,10S,13S,14S,17S)-3-fluoro-10-formyl-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(3S,8S,9S,10S,13S,14S,17S)-3-fluoro-10-formyl-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 101288230 |
| Molecular Formula | C21H29FO3 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | [(3S,8S,9S,10S,13S,14S,17S)-3-fluoro-10-formyl-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](F)CC[C@]4(C=O)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H29FO3/c1-13(24)25-19-6-5-17-16-4-3-14-11-15(22)7-10-21(14,12-23)18(16)8-9-20(17,19)2/h3,12,15-19H,4-11H2,1-2H3/t15-,16-,17-,18-,19-,20-,21+/m0/s1 |
| InChIKey | NBSVVIQHMIHLFR-NUNROCCHSA-N |
| XLogP | 4.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|