C22H33FO5S — CID 541173
[3-fluoro-13-methyl-10-(methylsulfonyloxymethyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 541173) has the molecular formula C22H33FO5S and a molecular weight of 428.57 g/mol. Its IUPAC name is [3-fluoro-13-methyl-10-(methylsulfonyloxymethyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [3-fluoro-13-methyl-10-(methylsulfonyloxymethyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 541173 |
| Molecular Formula | C22H33FO5S |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | [3-fluoro-13-methyl-10-(methylsulfonyloxymethyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)OC1CCC2C3CC=C4CC(F)CCC4(COS(C)(=O)=O)C3CCC12C |
| InChI | InChI=1S/C22H33FO5S/c1-14(24)28-20-7-6-18-17-5-4-15-12-16(23)8-11-22(15,13-27-29(3,25)26)19(17)9-10-21(18,20)2/h4,16-20H,5-13H2,1-3H3 |
| InChIKey | QWKZEYFBMZEDTI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|