C26H38O3 — CID 88686295
(8R,9R,10S,13S,14S)-10,13-dimethyl-1,2-dimethylidene-17-(oxan-2-yloxy)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 88686295) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-10,13-dimethyl-1,2-dimethylidene-17-(oxan-2-yloxy)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10S,13S,14S)-10,13-dimethyl-1,2-dimethylidene-17-(oxan-2-yloxy)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88686295 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | (8R,9R,10S,13S,14S)-10,13-dimethyl-1,2-dimethylidene-17-(oxan-2-yloxy)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C1C(=C)[C@@]2(C)C(CC[C@@H]3[C@H]2CC[C@]2(C)C(OC4CCCCO4)CC[C@@H]32)CC1=O |
| InChI | InChI=1S/C26H38O3/c1-16-17(2)26(4)18(15-22(16)27)8-9-19-20-10-11-23(25(20,3)13-12-21(19)26)29-24-7-5-6-14-28-24/h18-21,23-24H,1-2,5-15H2,3-4H3/t18?,19-,20-,21+,23?,24?,25-,26-/m0/s1 |
| InChIKey | JUMNWZZWIJCZHV-DMEJDIHMSA-N |
| XLogP | 5.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|