C25H41IO2 — CID 11944658
(2R)-2-[[(3S,5S,8S,9S,10S,13S,14S,17S)-17-(iodomethyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane (PubChem CID 11944658) has the molecular formula C25H41IO2 and a molecular weight of 500.51 g/mol. Its IUPAC name is (2R)-2-[[(3S,5S,8S,9S,10S,13S,14S,17S)-17-(iodomethyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane.
| Compound Name | (2R)-2-[[(3S,5S,8S,9S,10S,13S,14S,17S)-17-(iodomethyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane |
|---|---|
| PubChem CID | 11944658 |
| Molecular Formula | C25H41IO2 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | (2R)-2-[[(3S,5S,8S,9S,10S,13S,14S,17S)-17-(iodomethyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane |
| SMILES | C[C@]12CC[C@H](O[C@@H]3CCCCO3)C[C@@H]1CC[C@H]1[C@@H]2CC[C@]2(C)[C@@H](CI)CC[C@@H]12 |
| InChI | InChI=1S/C25H41IO2/c1-24-12-10-19(28-23-5-3-4-14-27-23)15-17(24)6-8-20-21-9-7-18(16-26)25(21,2)13-11-22(20)24/h17-23H,3-16H2,1-2H3/t17-,18+,19-,20+,21-,22-,23+,24-,25+/m0/s1 |
| InChIKey | VJCWEUYDXCVIJK-VGNRAECFSA-N |
| XLogP | 6.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|