C25H42O3 — CID 124902442
[(3S,5S,8R,9R,10S,13S,14S,17S)-10,13-dimethyl-3-[(2R)-oxan-2-yl]oxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]methanol (PubChem CID 124902442) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is [(3S,5S,8R,9R,10S,13S,14S,17S)-10,13-dimethyl-3-[(2R)-oxan-2-yl]oxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]methanol.
| Compound Name | [(3S,5S,8R,9R,10S,13S,14S,17S)-10,13-dimethyl-3-[(2R)-oxan-2-yl]oxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]methanol |
|---|---|
| PubChem CID | 124902442 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | [(3S,5S,8R,9R,10S,13S,14S,17S)-10,13-dimethyl-3-[(2R)-oxan-2-yl]oxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]methanol |
| SMILES | C[C@]12CC[C@H](O[C@@H]3CCCCO3)C[C@@H]1CC[C@@H]1[C@H]2CC[C@]2(C)[C@@H](CO)CC[C@@H]12 |
| InChI | InChI=1S/C25H42O3/c1-24-12-10-19(28-23-5-3-4-14-27-23)15-17(24)6-8-20-21-9-7-18(16-26)25(21,2)13-11-22(20)24/h17-23,26H,3-16H2,1-2H3/t17-,18+,19-,20-,21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | XSVLGQVTZZPPSN-QAMSCVPESA-N |
| XLogP | 5.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|