C24H40O5 — CID 90373895
1-[(3R,5S,10S,13S,17S)-3-(dimethoxymethoxy)-17-(hydroxymethyl)-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-13-yl]ethanone (PubChem CID 90373895) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is 1-[(3R,5S,10S,13S,17S)-3-(dimethoxymethoxy)-17-(hydroxymethyl)-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-13-yl]ethanone.
| Compound Name | 1-[(3R,5S,10S,13S,17S)-3-(dimethoxymethoxy)-17-(hydroxymethyl)-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-13-yl]ethanone |
|---|---|
| PubChem CID | 90373895 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 1-[(3R,5S,10S,13S,17S)-3-(dimethoxymethoxy)-17-(hydroxymethyl)-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-13-yl]ethanone |
| SMILES | COC(OC)O[C@@H]1CC[C@]2(C)C3CC[C@]4(C(C)=O)C(CC[C@@H]4CO)C3CC[C@H]2C1 |
| InChI | InChI=1S/C24H40O5/c1-15(26)24-12-10-20-19(21(24)8-6-17(24)14-25)7-5-16-13-18(9-11-23(16,20)2)29-22(27-3)28-4/h16-22,25H,5-14H2,1-4H3/t16-,17+,18+,19?,20?,21?,23-,24+/m0/s1 |
| InChIKey | RFNYYZSGLYGQOB-FEDGGPFKSA-N |
| XLogP | 4.17 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|