C34H58O5 — CID 22821654
(4R)-4-[(3R,5R,6S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3,6-bis(oxan-2-yloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-ol (PubChem CID 22821654) has the molecular formula C34H58O5 and a molecular weight of 546.83 g/mol. Its IUPAC name is (4R)-4-[(3R,5R,6S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3,6-bis(oxan-2-yloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-ol.
| Compound Name | (4R)-4-[(3R,5R,6S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3,6-bis(oxan-2-yloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-ol |
|---|---|
| PubChem CID | 22821654 |
| Molecular Formula | C34H58O5 |
| Molecular Weight | 546.83 g/mol |
| Exact Mass | 546.43 |
| IUPAC Name | (4R)-4-[(3R,5R,6S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3,6-bis(oxan-2-yloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-ol |
| SMILES | C[C@H](CCCO)[C@H]1CC[C@H]2[C@@H]3C[C@H](OC4CCCCO4)[C@@H]4C[C@H](OC5CCCCO5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H58O5/c1-23(9-8-18-35)26-12-13-27-25-22-30(39-32-11-5-7-20-37-32)29-21-24(38-31-10-4-6-19-36-31)14-16-34(29,3)28(25)15-17-33(26,27)2/h23-32,35H,4-22H2,1-3H3/t23-,24-,25+,26-,27+,28+,29+,30+,31?,32?,33-,34-/m1/s1 |
| InChIKey | KYQJMBFCXVGUHU-DCZVKRHRSA-N |
| XLogP | 7.49 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.83 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|