C31H50O5 — CID 121431658
ethyl (4R)-4-[(3R,10S,13R)-10,13-dimethyl-3-(oxan-2-yloxy)-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 121431658) has the molecular formula C31H50O5 and a molecular weight of 502.74 g/mol. Its IUPAC name is ethyl (4R)-4-[(3R,10S,13R)-10,13-dimethyl-3-(oxan-2-yloxy)-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | ethyl (4R)-4-[(3R,10S,13R)-10,13-dimethyl-3-(oxan-2-yloxy)-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 121431658 |
| Molecular Formula | C31H50O5 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.37 |
| IUPAC Name | ethyl (4R)-4-[(3R,10S,13R)-10,13-dimethyl-3-(oxan-2-yloxy)-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CCOC(=O)CC[C@@H](C)C1CCC2C3C(=O)CC4C[C@H](OC5CCCCO5)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C31H50O5/c1-5-34-27(33)12-9-20(2)23-10-11-24-29-25(14-16-31(23,24)4)30(3)15-13-22(18-21(30)19-26(29)32)36-28-8-6-7-17-35-28/h20-25,28-29H,5-19H2,1-4H3/t20-,21?,22-,23?,24?,25?,28?,29?,30+,31-/m1/s1 |
| InChIKey | QGTGJUSXZBDMJL-GQVBNGOOSA-N |
| XLogP | 6.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|