C32H48O5S — CID 124902030
[(3R,5S,8R,9R,10S,13S,14S,17S)-10,13-dimethyl-3-[(2S)-oxan-2-yl]oxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl 4-methylbenzenesulfonate (PubChem CID 124902030) has the molecular formula C32H48O5S and a molecular weight of 544.80 g/mol. Its IUPAC name is [(3R,5S,8R,9R,10S,13S,14S,17S)-10,13-dimethyl-3-[(2S)-oxan-2-yl]oxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3R,5S,8R,9R,10S,13S,14S,17S)-10,13-dimethyl-3-[(2S)-oxan-2-yl]oxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 124902030 |
| Molecular Formula | C32H48O5S |
| Molecular Weight | 544.80 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | [(3R,5S,8R,9R,10S,13S,14S,17S)-10,13-dimethyl-3-[(2S)-oxan-2-yl]oxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2CC[C@H]3[C@@H]4CC[C@H]5C[C@H](O[C@H]6CCCCO6)CC[C@]5(C)[C@@H]4CC[C@]23C)cc1 |
| InChI | InChI=1S/C32H48O5S/c1-22-7-11-26(12-8-22)38(33,34)36-21-24-10-14-28-27-13-9-23-20-25(37-30-6-4-5-19-35-30)15-17-31(23,2)29(27)16-18-32(24,28)3/h7-8,11-12,23-25,27-30H,4-6,9-10,13-21H2,1-3H3/t23-,24+,25+,27-,28-,29+,30-,31-,32+/m0/s1 |
| InChIKey | LLXZXIZDIOAGLB-HWGSMBBJSA-N |
| XLogP | 7.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.80 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|