C26H39NO2 — CID 99571188
(2E)-2-[(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-3-[(2R)-oxan-2-yl]oxy-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene]acetonitrile (PubChem CID 99571188) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is (2E)-2-[(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-3-[(2R)-oxan-2-yl]oxy-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene]acetonitrile.
| Compound Name | (2E)-2-[(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-3-[(2R)-oxan-2-yl]oxy-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene]acetonitrile |
|---|---|
| PubChem CID | 99571188 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | (2E)-2-[(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-3-[(2R)-oxan-2-yl]oxy-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene]acetonitrile |
| SMILES | C[C@]12CC[C@H](O[C@@H]3CCCCO3)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)/C(=C/C#N)CC[C@@H]12 |
| InChI | InChI=1S/C26H39NO2/c1-25-14-11-23-21(22(25)9-7-18(25)12-15-27)8-6-19-17-20(10-13-26(19,23)2)29-24-5-3-4-16-28-24/h12,19-24H,3-11,13-14,16-17H2,1-2H3/b18-12+/t19-,20-,21-,22-,23-,24+,25+,26-/m0/s1 |
| InChIKey | ULTCYCMQPDCQLQ-SFGXCCCVSA-N |
| XLogP | 6.39 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|