C23H33NO3 — CID 123354118
[(2S,3S,5S,8R,9S,10S,13S,14S)-17-(cyanomethylidene)-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-2-yl] acetate (PubChem CID 123354118) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is [(2S,3S,5S,8R,9S,10S,13S,14S)-17-(cyanomethylidene)-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-2-yl] acetate.
| Compound Name | [(2S,3S,5S,8R,9S,10S,13S,14S)-17-(cyanomethylidene)-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 123354118 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | [(2S,3S,5S,8R,9S,10S,13S,14S)-17-(cyanomethylidene)-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C(=CC#N)CC[C@@H]32)C[C@@H]1O |
| InChI | InChI=1S/C23H33NO3/c1-14(25)27-21-13-23(3)16(12-20(21)26)4-6-17-18-7-5-15(9-11-24)22(18,2)10-8-19(17)23/h9,16-21,26H,4-8,10,12-13H2,1-3H3/t16-,17-,18-,19-,20-,21-,22+,23-/m0/s1 |
| InChIKey | CZAAFXLYKQLWGT-COGXALLJSA-N |
| XLogP | 4.38 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|